LN-277426
Dihydromyrcene , 2436-90-0
Synonym(s):
(S)-(+)-3,7-Dimethyl-1,6-octadiene
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | -69.6°C (estimate) |
| Boiling point: | 154-155 °C(lit.) |
| Density | 0.760 g/mL at 20 °C(lit.) |
| vapor pressure | 4.09hPa at 20℃ |
| refractive index | n |
| Flash point: | 38 °C |
| storage temp. | 2-8°C |
| Odor | at 100.00 %. citronellol herbal citrus terpenic |
| Appearance | Colorless to light yellow Liquid |
| Odor Type | floral |
| Water Solubility | 2.24mg/L at 20℃ |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | InChI=1S/C10H18/c1-5-10(4)8-6-7-9(2)3/h5,7,10H,1,6,8H2,2-4H3 |
| InChIKey | FUDNBFMOXDUIIE-UHFFFAOYSA-N |
| SMILES | C=CC(C)CC/C=C(\C)/C |
| LogP | 5.796 at 25℃ |
| CAS DataBase Reference | 2436-90-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Dimethyl 2,7-octadiene(2436-90-0) |
| EPA Substance Registry System | Dihydromyrcene (2436-90-0) |
Description and Uses
Dihydromyrcene is used as a fragrance intermediate and can be used to synthesize dihydromyrcenol.
Safety
| Symbol(GHS) |     GHS08,GHS07,GHS02,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H304-H226-H400-H410-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P273-P391-P501-P273-P391-P501 |
| RIDADR | UN 2319 3/PG 3 |
| WGK Germany | 2 |
| RTECS | RG5340000 |
| F | 10 |
| TSCA | TSCA listed |
