LN-314493
5-FLUOROURACIL-15N2 , 99% , 68941-95-7
Synonym(s):
5-fluoro-2,4(1H,3H)-Pyrimidinedione-1,3-15N2
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 282-286 °C(lit.) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)/i6+1,7+1 |
| InChIKey | GHASVSINZRGABV-AKZCFXPHSA-N |
| SMILES | FC1=C[15NH]C(=O)[15NH]C1=O |
| CAS Number Unlabeled | 51-21-8 |
Description and Uses
5-Fluorouracil-15N2 (CAS# 68941-95-7) is a useful isotopically labeled research compound. This compound can be used for isotopic analysis by gas chromatography-mass spectroscopy for various pyrimidine metabolites and antimetabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H302-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
