LN-353928
Bis(4-(diphenylsulfonio)phenyl)sulfide bis(hexafluorophosphate) , 0.99 , 74227-35-3
CAS NO.:74227-35-3
Empirical Formula: C36H28S3.2F6P
Molecular Weight: 846.74
MDL number: MFCD03427287
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 230-240 °C |
| Density | 1,31 g/cm3 |
| vapor pressure | 0.002Pa at 20℃ |
| refractive index | n20/D 1.515 |
| Specific Gravity | 1.31 |
| Water Solubility | 74mg/L at 20℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChIKey | YLVPBWWLXQQGJS-UHFFFAOYSA-N |
| SMILES | [S+](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C(SC2C=CC([S+](C3C=CC=CC=3)C3=CC=CC=C3)=CC=2)C=C1.[P-](F)(F)(F)(F)(F)F.[P-](F)(F)(F)(F)(F)F |
| LogP | 1 at 20℃ |
| CAS DataBase Reference | 74227-35-3(CAS DataBase Reference) |
| EPA Substance Registry System | Sulfonium, (thiodi-4,1-phenylene)bis[diphenyl-, bis[hexafluorophosphate(1-)] (74227-35-3) |
Description and Uses
Used in UV-curable coatings and inks.
Safety
| Symbol(GHS) | ![]() ![]() GHS09,GHS05 |
| Signal word | Danger |
| Hazard statements | H410-H318 |
| Precautionary statements | P280-P305+P351+P338-P310-P273-P391-P501 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53-43-36 |
| Safety Statements | 26-36/37/39-61-60-37-24-36 |
| TSCA | TSCA listed |
| REACH Registrations | Active |







