A3184612
Dithizone , AR , 60-10-6
Synonym(s):
Diphenylthiocarbazone;Dithizone
CAS NO.:60-10-6
Empirical Formula: C13H12N4S
Molecular Weight: 256.33
MDL number: MFCD00003025
EINECS: 200-454-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB60.00 | In Stock |
|
| 25G | RMB254.40 | In Stock |
|
| 100G | RMB756.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168 °C (dec.) (lit.) |
| Boiling point: | 376.1±25.0 °C(Predicted) |
| bulk density | 250kg/m3 |
| Density | 1.2578 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | no restrictions. |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | pK1:4.50;pK2:15 (25°C) |
| form | Crystalline |
| color | Black powder |
| Water Solubility | Soluble in ethanol, chloroform, dimethylsulfoxide, and pyridine. Insoluble in water. |
| λmax | 604-607 nm in chloroform |
| Merck | 14,3377 |
| BRN | 748838 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C13H12N4S/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14H,(H,16,18) |
| InChIKey | UOFGSWVZMUXXIY-UHFFFAOYSA-N |
| SMILES | S=C(NNc2ccccc2)N=Nc1ccccc1 |
| CAS DataBase Reference | 60-10-6(CAS DataBase Reference) |
| EPA Substance Registry System | Diazenecarbothioic acid, phenyl-, 2-phenylhydrazide (60-10-6) |
Description and Uses
Dithizone is an organosulfur compound that acts as a chelating agent and forms complexes with metals such as lead and mercury. Dithizone is used to assess the purity of human pancreatic islet preparations used for transplantation into patients with type 1 diabetes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | LQ9450000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |




