LN-371126
Potassium dimethyldithiocarbamate , 128-03-0
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 100°C |
| Density | 1.23-1.51 at 20℃ |
| vapor pressure | 0-0Pa at 20-25℃ |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | liquid |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| InChI | InChI=1S/C3H7NS2.K/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1 |
| InChIKey | TVPFLPJBESCUKI-UHFFFAOYSA-M |
| SMILES | [K+].C(=S)([S-])N(C)C |
| LogP | -3.2--2.28 at pH5-9 |
| Dissociation constant | 4.21 |
| CAS DataBase Reference | 128-03-0(CAS DataBase Reference) |
| EPA Substance Registry System | Potassium dimethyldithiocarbamate (128-03-0) |
Description and Uses
Busan 85 is a useful intermediate that has been used in the synthetic preparation of sulfonamide carbonic anhydrase inhibitors as antitumor agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H400 |
| Precautionary statements | P264-P280-P302+P352-P321 |
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | FA0850000 |
| HS Code | 2934208090 |
| Hazardous Substances Data | 128-03-0(Hazardous Substances Data) |
| Toxicity | mouse,LD50,intraperitoneal,350mg/kg (350mg/kg),Acta Pharmacologica et Toxicologica. Vol. 8, Pg. 329, 1952. |






