LN-381461
Rebeprazole sulfone N-oxide , 99% , 924663-37-6
CAS NO.：924663-37-6
Empirical Formula: C18H21N3O5S
Molecular Weight: 391.44
MDL number: MFCD09841220
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 153-156 °C |
| Boiling point: | 696.9±65.0 °C(Predicted) |
| Density | 1.36 |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.92±0.10(Predicted) |
| color | Off-White to Beige |
| Major Application | pharmaceutical |
| InChI | 1S/C18H21N3O5S/c1-13-16(21(22)9-8-17(13)26-11-5-10-25-2)12-27(23,24)18-19-14-6-3-4-7-15(14)20-18/h3-4,6-9H,5,10-12H2,1-2H3,(H,19,20) |
| InChIKey | FZBHTBNDQGWAAS-UHFFFAOYSA-N |
| SMILES | [S](=O)(=O)(Cc3[n+](ccc(c3C)OCCCOC)[O-])c1[nH]c2c(n1)cccc2 |
Description and Uses
Rabeprazole Sulfone N-Oxide (Rabeprazole EP Impurity I) is a potential impurity of Rabeprazole (R070500) sodium.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
