LN-408225
Tiglic aldehyde , 1115-11-3
Synonym(s):
(E)-2-Methylbut-2-enal;trans-2,3-Dimethylacrolein;trans-2-Methyl-2-butenal;Tiglic aldehyde;Tiglinaldehyde
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | -101.15°C (estimate) |
| Boiling point: | 116-119 °C |
| Density | 0.871 |
| FEMA | 3407 | 2-METHYL-2-BUTENAL |
| refractive index | 1.448 |
| Flash point: | 21 °C |
| Odor | at 1.00 % in dipropylene glycol. pungent green ethereal nutty anisic fruity |
| Odor Type | green |
| Water Solubility | 2.5% soluble in water |
| JECFA Number | 1201 |
| InChI | InChI=1S/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3 |
| InChIKey | ACWQBUSCFPJUPN-UHFFFAOYSA-N |
| SMILES | C(=O)C(C)=CC |
| LogP | 1.07 |
| NIST Chemistry Reference | 2-Butenal, 2-methyl-(1115-11-3) |
Description and Uses
Tiglic aldehyde has found little use in perfume compositions mainly as a trace component in special topnote compositions, bases, etc. It will support fruity, green and vinous notes, and it has interesting effects in Geranium, Clary Sage, etc.
Safety
| Hazard Codes | F,Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1989 |
