LN-479825
Cephalexin Sulfoxide , 96%-99% , 56193-21-6
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >179°C (dec.) |
| Boiling point: | 830.979±65.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.597±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | DMSO, Methanol |
| form | Solid |
| pka | 2.909±0.40(predicted) |
| color | Off-White |
| Stability: | Unstable in Solution |
| InChI | InChI=1/C16H17N3O5S/c1-8-7-25(24)15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-6,10-11,15H,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-,25/s3 |
| InChIKey | GAMHLNJQISGSQF-KFAWQCHLNA-N |
| SMILES | CC1CS(=O)[C@]2([H])[C@@H](C(=O)N2C=1C(=O)O)NC(=O)[C@@H](C1=CC=CC=C1)N |&1:5,7,18,r| |
Description and Uses
Cephalexin sulfoxide is a derivative of Cephalexin, a Cephalosporin derivative with bactericidal activity.






