LN-529728
1-CHLORO-1-FLUOROETHYLENE , 0.95&0.99 , 2317-91-1
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | -169°C |
| Boiling point: | -24°C |
| Density | 2.618 g/cm3 |
| InChI | InChI=1S/C2H2ClF/c1-2(3)4/h1H2 |
| InChIKey | FPBWSPZHCJXUBL-UHFFFAOYSA-N |
| SMILES | C(Cl)(F)=C |
| CAS DataBase Reference | 2317-91-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethene, 1-chloro-1-fluoro-(2317-91-1) |
| EPA Substance Registry System | Ethene, 1-chloro-1-fluoro- (2317-91-1) |
Description and Uses
1-Chloro-1-fluoroethylene is an organic synthesis intermediate used to prepare fluoropolymers and coatings, and can also be used as a raw material for refrigerants and cleaning agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS04,GHS02 |
| Signal word | Warning |
| Hazard statements | H280-H315-H319-H335-H221 |
| Precautionary statements | P210-P260-P280 |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 9-16-23 |
| RIDADR | 3161 |
| Hazard Note | Flammable |
| HazardClass | GAS, FLAMMABLE |
| HS Code | 2903793090 |







