LN-539332
2,4-Dichlorobenzenediazonium 1,5-naphthalenedisulfonate hydrate , 98% Min. , 123333-91-5
Synonym(s):
2,4-DCPD;2,4-Dichlorophenyldiazonium 1,5-naphthalenedisulfonate
CAS NO.：123333-91-5
Empirical Formula: C22H14Cl4N4O7S2
Molecular Weight: 652.31
MDL number: MFCD08457580
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 195℃ |
| storage temp. | 2-8°C |
| form | powder |
| color | faint yellow |
| Sensitive | Hygroscopic |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C10H8O6S2.C6H3Cl2N2.H2O/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;7-4-1-2-6(10-9)5(8)3-4;/h1-6H,(H,11,12,13)(H,14,15,16);1-3H;1H2/q;+1;/p-1 |
| InChIKey | SPGAUZWLXGQOLT-UHFFFAOYSA-M |
| SMILES | C1C([N+]#N)=C(Cl)C=C(Cl)C=1.C12C=CC=C(S(=O)(=O)O)C=1C=CC=C2S(=O)(=O)[O-].O |
Description and Uses
2,4-Dichlorobenzenediazonium 1,5-naphthalenedisulfonate is a useful stain utilized for total bilirubin spectrophotometric detection in serum. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
