LN-557178
FLUORENE-D10 , 99%HPLC , 81103-79-9
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 115-118 °C(lit.) |
| Flash point: | 151 °C |
| storage temp. | room temp |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to off-white |
| Major Application | electronics |
| InChI | 1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D2 |
| InChIKey | NIHNNTQXNPWCJQ-QNNBDYQESA-N |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c3c([2H])c([2H])c([2H])c([2H])c3C2([2H])[2H] |
| EPA Substance Registry System | Fluorene-d10 (81103-79-9) |
| CAS Number Unlabeled | 86-73-7 |
Description and Uses
Fluorene-D10 is a labelled analogue of Fluorene (F462000). Fluorene is a polycyclic aromatic hydrocarbon that is ubiquitous in the urban environment, and is also a suspected carcinogen. Fluorene is used as a component of fluorescent probes that bind to human serum albumin, allowing researchers to study internal mechanisms more closely.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410-H413 |
| Precautionary statements | P273-P501 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 22-24/25-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | LL5670000 |
| HS Code | 28459000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
