LN-616328
2-(4-((3-Chloro-5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)-propanoic acid methyl ester , 0.95&0.99 , 72619-32-0
Synonym(s):
(R)-2-{4-[3-Chloro-5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propanoic acid methyl ester
CAS NO.:72619-32-0
Empirical Formula: C16H13ClF3NO4
Molecular Weight: 375.73
MDL number: MFCD04112762
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 390.8±42.0 °C(Predicted) |
| Density | 0.968 |
| vapor pressure | 0Pa at 20℃ |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | -1.52±0.32(Predicted) |
| Water Solubility | 8.74 mg/L at 20 ºC |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C16H13ClF3NO4/c1-9(15(22)23-2)24-11-3-5-12(6-4-11)25-14-13(17)7-10(8-21-14)16(18,19)20/h3-9H,1-2H3/t9-/m1/s1 |
| InChIKey | MFSWTRQUCLNFOM-SECBINFHSA-N |
| SMILES | C(OC)(=O)[C@H](OC1=CC=C(OC2=NC=C(C(F)(F)F)C=C2Cl)C=C1)C |
| LogP | 4 at 20℃ |
| CAS DataBase Reference | 72619-32-0(CAS DataBase Reference) |
Description and Uses
Haloxyfop-R-methyl-d3 is a labeled analogue of (R)-Haloxyfop Methyl Ester (H104020), which is a herbicide. It is used in the study of reduced rates of the acetyl-co enzyme A carboxylase (ACCase)-inhibiting herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn;N,N,Xn,F |
| Risk Statements | 22-50/53-36-20/21/22-11 |
| Safety Statements | 2-60-61-36/37-26-16 |
| RIDADR | UN1648 3/PG 2 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |




