LN-667820
TOBRAMYCIN A , > 95% , 20744-51-8
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >135°C (dec.) |
| Boiling point: | 613.3±55.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly, Heated, Sonicated) |
| pka | 13.07±0.70(Predicted) |
| form | Solid |
| color | Off-White to Brown |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1/C12H25N3O7/c13-3-1-4(14)11(10(20)7(3)17)22-12-9(19)6(15)8(18)5(2-16)21-12/h3-12,16-20H,1-2,13-15H2/t3-,4+,5+,6-,7+,8+,9+,10-,11-,12+/s3 |
| InChIKey | WPYNTQYMFOTKRF-STYUYWDLNA-N |
| SMILES | [C@@H]1([C@H](N)C[C@H](N)[C@@H](O)[C@@H]1O)O[C@@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)N |&1:0,1,4,6,8,11,12,14,15,17,r| |
Description and Uses
An impurity of Tobramycin (T524000).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |






