LN-685326
Desloratadine Pyridine N-oxide , 98% ,981 ,email:hanne@coreychem.com , 169253-26-3
CAS NO.:169253-26-3
Empirical Formula: C19H19ClN2O
Molecular Weight: 326.82
MDL number: MFCD11977840
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >199°C (dec.) |
| Boiling point: | 548.0±50.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 10.09±0.20(Predicted) |
| form | Solid |
| color | Off-White to Beige |
| Stability: | Light Sensitive |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C19H19ClN2O/c20-16-5-6-17-15(12-16)4-3-14-2-1-11-22(23)19(14)18(17)13-7-9-21-10-8-13/h1-2,5-6,11-12,21H,3-4,7-10H2 |
| InChIKey | ZTRQZDOHUHWANO-UHFFFAOYSA-N |
| SMILES | C12/C(=C3\CCNCC\3)/C3=CC=C(Cl)C=C3CCC=1C=CC=[N+]2[O-] |
Description and Uses
A degradation product of Desloratadine. Desloratadine impurity.
Safety
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






