LN-996334
Desloratadine N-Hydroxypiperidine , 0.95 , 1193725-73-3
CAS NO.:1193725-73-3
Empirical Formula: C19H19ClN2O
Molecular Weight: 326.82
MDL number: MFCD28898432
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >165°C (dec.) |
| Boiling point: | 515.3±50.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 13.23±0.20(Predicted) |
| color | Pale Orange to Brown |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C19H19ClN2O/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-21-19(14)18(17)13-7-10-22(23)11-8-13/h1-2,5-6,9,12,23H,3-4,7-8,10-11H2 |
| InChIKey | AMIBINHLAUROKH-UHFFFAOYSA-N |
| SMILES | C12/C(=C3\CCN(O)CC\3)/C3=CC=C(Cl)C=C3CCC1=CC=CN=2 |
Description and Uses
A related compound of Desloratadine (D290250).
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H411 |
| Precautionary statements | P264-P273-P280-P301+P312-P305+P351+P338-P391 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 |






![8-Chloro-11-(1-methylpiperidin-4-yl)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ol](https://img.chemicalbook.com/CAS/GIF/38089-93-9.gif)
![8-Chloro-11-fluoro-6,11-dihydro-11-(4-piperidinyl)-5H-benzo[5,6]cyclohepta[1,2-b]pyridine](https://img.chemicalbook.com/CAS/GIF/298220-99-2.gif)

