LN-726533
3-(4'-Bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol , 99 , 56181-82-9
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 155-157°C |
| Boiling point: | 512.8±50.0 °C(Predicted) |
| Density | 1.359±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| pka | 14.15±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C22H19BrO/c23-20-11-9-16(10-12-20)15-5-7-17(8-6-15)19-13-18-3-1-2-4-21(18)22(24)14-19/h1-12,19,22,24H,13-14H2 |
| InChIKey | LGYMGAWTNGCUFA-UHFFFAOYSA-N |
| SMILES | C1(O)C2=C(C=CC=C2)CC(C2=CC=C(C3=CC=C(Br)C=C3)C=C2)C1 |
| EPA Substance Registry System | 1-Naphthalenol, 3-(4'-bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro- (56181-82-9) |
Description and Uses
3-(4''-Bromo[1,1''-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol is used to prepare 4-hydroxycoumarin derivatives with antitumor activities. It is also used to synthesize diphenacoum and brodifacoum (B677900) as the rodenticides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501 |
| TSCA | TSCA listed |

![3-(4'-Bromo[1,1'-biphenyl]-4-yl)-1,2,3,4-tetrahydro-1-naphthalenol](https://img.chemicalbook.com/CAS/GIF/56181-82-9.gif)

