LN-760828
Flutriafol , 0.99 , 76674-21-0
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 130° |
| Boiling point: | 506.5±60.0 °C(Predicted) |
| Density | 1.3015 (estimate) |
| vapor pressure | 7.1 x l0-9 Pa (20 °C) |
| Flash point: | 2 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 11.60±0.29(Predicted) |
| form | Solid |
| Water Solubility | 130 mg l-1 (pH 7,20 °C) |
| color | White to Off-White |
| Merck | 13,4240 |
| BRN | 8155287 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | agriculture environmental |
| InChI | 1S/C16H13F2N3O/c17-13-7-5-12(6-8-13)16(22,9-21-11-19-10-20-21)14-3-1-2-4-15(14)18/h1-8,10-11,22H,9H2 |
| InChIKey | JWUCHKBSVLQQCO-UHFFFAOYSA-N |
| SMILES | OC(Cn1cncn1)(c2ccc(F)cc2)c3ccccc3F |
| LogP | 2.290 |
| CAS DataBase Reference | 76674-21-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Flutriafol(76674-21-0) |
| EPA Substance Registry System | Flutriafol (76674-21-0) |
Description and Uses
Agricultural fungicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,F |
| Risk Statements | 22-36-20/21/22-11 |
| Safety Statements | 22-24/25-36-26 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| RTECS | XZ4825000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| Toxicity | LD50 male, female rats (mg/kg): 1140, 1480 orally; rats, rabbits: >1000, >2000 percutaneously (Skidmore) |





