LN-826930
Orysastrobin , 248593-16-0
Synonym(s):
(2E)-2-(Methoxyimino)-2-{2-[(3E,5E,6E)-5-(methoxyimino)-4,6-dimethyl-2,8-dioxa-3,7-diazanona-3,6-dien-1-yl]phenyl}-N-methylacetamide
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 97～101℃ |
| Density | 1.16±0.1 g/cm3(Predicted) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 11.26±0.46(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 11330196 |
| Major Application | agriculture environmental |
| InChI | 1S/C18H25N5O5/c1-12(20-25-4)16(22-26-5)13(2)21-28-11-14-9-7-8-10-15(14)17(23-27-6)18(24)19-3/h7-10H,11H2,1-6H3,(H,19,24)/b20-12+,21-13+,22-16+,23-17+ |
| InChIKey | JHIPUJPTQJYEQK-ZLHHXESBSA-N |
| SMILES | CNC(=O)C(=N\OC)\c1ccccc1CO\N=C(C)\C(=N\OC)\C(C)=N\OC |
Description and Uses
Orysastrobin is a fungicide used in the treatment of blast and sheath blight in transplanted rice inhibiting the mitochondrial respiration chain.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H351-H410 |
| Precautionary statements | P201-P202-P273-P301+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | Xn,N |
| Risk Statements | 20/22-40-50/53 |
| Safety Statements | 22-36/37-46-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
