LN-910633
DIMETHYLVINPHOS , 0.99 , 2274-67-1
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 69.5 °C |
| Boiling point: | 126 °C(Press: 0.05 Torr) |
| Density | 1.448±0.06 g/cm3(Predicted) |
| vapor pressure | 1.3 x 10-3 Pa (25 °C) |
| storage temp. | -20°C |
| Water Solubility | 130 mg l-1(20 °C) |
| InChI | 1S/C10H10Cl3O4P/c1-15-18(14,16-2)17-10(6-11)8-4-3-7(12)5-9(8)13/h3-6H,1-2H3/b10-6- |
| InChIKey | QSGNQELHULIMSJ-POHAHGRESA-N |
| SMILES | COP(=O)(OC)O\C(=C/Cl)c1ccc(Cl)cc1Cl |
Description and Uses
Dimethylvinphos is used to control stem borers and leaf rollers in rice.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H410 |
| Precautionary statements | P273-P301+P310+P330 |
| Hazard Codes | T,N |
| Risk Statements | 25-50/53 |
| Safety Statements | 45-60-61 |
| RIDADR | 2783 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29199000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |





