LN-911928
1,1,3,3-TETRAMETHYLDISILOXANE , 0.99 , 30110-74-8
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 70-71 °C(lit.) |
| Density | 0.76 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 14 °F |
| storage temp. | 2-8°C |
| InChI | InChI=1S/C4H14OSi2/c1-6(2)5-7(3)4/h6-7H,1-4H3 |
| InChIKey | NVYQDQZEMGUESH-UHFFFAOYSA-N |
| SMILES | [SiH](C)(C)O[SiH](C)C |
| EPA Substance Registry System | Disiloxane, tetramethyl- (30110-74-8) |
Description and Uses
Reduces aromatic aldehydes to benzyl halides. Used in the reductive halogenation of aldehydes and epoxides.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H319-H335-H315-H225 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P210-P233-P240-P241-P242-P243-P280-P303+P361+P353-P370+P378-P403+P235-P501 |
| Hazard Codes | F |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| RTECS | JN1000000 |
| F | 10-21 |
| TSCA | TSCA listed |








