LN-932226
TYRPHOSTIN AG 1290 , 0.99summer , 160391-70-8
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 478.9±45.0 °C(Predicted) |
| Density | 1.744±0.06 g/cm3(Predicted) |
| form | Yellow to green solid. |
| pka | 0.51±0.10(Predicted) |
| InChI | InChI=1S/C10H6N2O6/c11-4-6(10(15)16)1-5-2-7(12(17)18)9(14)8(13)3-5/h1-3,13-14H,(H,15,16)/b6-1+ |
| InChIKey | XDDDOLQEZBJWFZ-LZCJLJQNSA-N |
| SMILES | C(O)(=O)/C(/C#N)=C/C1=CC([N+]([O-])=O)=C(O)C(O)=C1 |
Description and Uses
Entacapone Acid, is the acid derivative of Entacapone (E558500). (E)-Isomer of Entacapone polymorphic form A. Peripherally acting inhibitor of catechol-O-methyl transferase (COMT), an enzyme involved in the metabolism of catecholamine neurotransmitters and related drugs. Antiparkinsonian.



![(alphaE)-alpha-[(3,4-Dihydroxy-5-nitrophenyl)methylene]-beta-oxo-1-piperidinepropanenitrile](https://img.chemicalbook.com/CAS/20150408/GIF/1150310-15-8.gif)


