LN-936726
DIOXOLANE418 , 95%~99.99% heidi@coreychem.com , 60644-92-0
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 121.9±40.0 °C(Predicted) |
| Density | 1.82±0.1 g/cm3(Predicted) |
| form | liquid |
| color | Clear |
| InChI | InChI=1S/C5Cl2F8O2/c6-2(8)3(7,9)17-1(16-2,4(10,11)12)5(13,14)15 |
| InChIKey | PQTSJAIWJYMBOX-UHFFFAOYSA-N |
| SMILES | O1C(Cl)(F)C(Cl)(F)OC1(C(F)(F)F)C(F)(F)F |
| EPA Substance Registry System | 1,3-Dioxolane, 4,5-dichloro-4,5-difluoro-2,2-bis(trifluoromethyl)- (60644-92-0) |
Description and Uses
4,5-dichloro-4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxolane (also known as Dioxolane 418) is an organic fluorine compound that contains substances that can be used to synthesize other fluorinating reagents. It reacts with magnesium in hot tetrahydrofuran to form 4,5-difluoro-2,2-bis(trifluoromethyl)-1,3-dioxole.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302+H312+H332 |
| Precautionary statements | P210-P260-P280 |
| HS Code | 2932990090 |
