LN-981021
PD 168 077 MALEATE , 99% , 190383-31-4
Synonym(s):
N-[[4-(2-Cyanophenyl)-1-piperazinyl]methyl]-3-methylbenzamide maleate salt
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 554.6±50.0 °C(Predicted) |
| Density | 1.22±0.1 g/cm3(Predicted) |
| solubility | DMSO: >10 mg/mL |
| pka | 14.89±0.46(Predicted) |
| form | powder |
| color | white |
| InChIKey | NAEUGRPISCANHO-BTJKTKAUSA-N |
| SMILES | [H]\C(=C(/[H])C(O)=O)C(O)=O.Cc1cccc(c1)C(=O)NCN2CCN(CC2)c3ccccc3C#N |
Description and Uses
The dopamine receptors play important role in cognition, memory, learning, and motor control (1). These receptors have been implicated as a therapeutic target for many psychiatric and neurological disorders. PD 168077 is a D4 dopamine receptor agonist and can be used to study ligand-receptor interactions of dopamine receptors (2).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |




