LN-991126
Haloxyfop-etotyl , 99% contact email : jessie@coreychem.com , 87237-48-7
CAS NO.：87237-48-7
Empirical Formula: C19H19ClF3NO5
Molecular Weight: 433.81
MDL number: MFCD00144430
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 60°C |
| Boiling point: | 463.4±45.0 °C(Predicted) |
| Density | 1.3400 |
| Flash point: | >100 °C |
| pka | -1.53±0.32(Predicted) |
| BRN | 8397167 |
| Major Application | agriculture environmental |
| InChI | 1S/C19H19ClF3NO5/c1-3-26-8-9-27-18(25)12(2)28-14-4-6-15(7-5-14)29-17-16(20)10-13(11-24-17)19(21,22)23/h4-7,10-12H,3,8-9H2,1-2H3 |
| InChIKey | MIJLZGZLQLAQCM-UHFFFAOYSA-N |
| SMILES | CCOCCOC(=O)C(C)Oc1ccc(Oc2ncc(cc2Cl)C(F)(F)F)cc1 |
| CAS DataBase Reference | 87237-48-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Haloxyfop-ethoxyethyl(87237-48-7) |
Description and Uses
Haloxyfop-etotyl is a herbicide that is active against most grasses.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P273-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 22-36-60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | UA2458260 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
