LN0104547
Fluroxypyr , 100 μg/ml (analysis standard reagent) , 69377-81-7
Synonym(s):
2-[(4-Amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetic acid;4-Amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid
CAS NO.:69377-81-7
Empirical Formula: C7H5Cl2FN2O3
Molecular Weight: 255.03
MDL number: MFCD01311822
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB245.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57.5°C |
| Boiling point: | 399.4±37.0 °C(Predicted) |
| Density | 1.3 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.22±0.10(Predicted) |
| color | White to Off-White |
| Merck | 13,4229 |
| BRN | 7136185 |
| Major Application | agriculture environmental |
| InChI | 1S/C7H5Cl2FN2O3/c8-3-5(11)4(9)7(12-6(3)10)15-1-2(13)14/h1H2,(H2,11,12)(H,13,14) |
| InChIKey | MEFQWPUMEMWTJP-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)c(F)nc(OCC(O)=O)c1Cl |
| LogP | 3.160 (est) |
| CAS DataBase Reference | 69377-81-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Fluroxypyr(69377-81-7) |
| EPA Substance Registry System | Fluroxypyr (69377-81-7) |
Description and Uses
Fluroxypyr is a systemic and selective herbicide. Fluroxypyr is used for the control of broad-leaved weeds in small grain cereals, maize, pastures, range land and turf. Fluroxypyr is a synthetic auxin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H412 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Faceshields, Gloves |
| Risk Statements | 52/53 |
| Safety Statements | 61 |
| RIDADR | UN3077(solid) |
| WGK Germany | 2 |
| RTECS | AF2500000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 |
| Hazardous Substances Data | 69377-81-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 2405 mg/kg; i.p. in male, female rats: 458, 519 mg/kg; percutaneous in rabbits >5000 mg/kg (Paul) |





