PRODUCT Properties
| Melting point: | 212-214°C |
| alpha | D21 -29° (c = 0.5 in chloroform) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | White to Off-White |
| InChIKey | JVKYZPBMZPJNAJ-OQFNDJACSA-N |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](C)[C@H]3[C@H](C[C@H]4[C@@H]5CC=C6C[C@@H](O)CC[C@]6(C)[C@H]5CC[C@]34C)N2C1 |
| LogP | 7.100 (est) |
Description and Uses
Soladine has been shown to display mutagenic properties in the liver, and is stored in the body for prolonged periods of time.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H361d-H413 |
| Precautionary statements | P202-P264-P270-P273-P301+P312-P308+P313 |
| Hazard Codes | T+,Xn |
| Risk Statements | 23/24/25-53-22 |
| Safety Statements | 2-13-45-36/37/39-22 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | WF0500000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Repr. 2 |
