LN0444727
≥97% , 210529-62-7
CAS NO.:210529-62-7
Empirical Formula: C11H13FN4O5
Molecular Weight: 300.24
MDL number: MFCD00155643
| Pack Size | Price | Stock | Quantity |
| 0.25g | RMB1000.00 | In Stock |
|
| 1g | RMB2320.00 | In Stock |
|
| 5g | RMB5200.00 | In Stock |
|
| 10g | RMB7920.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-177 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| color | Pale Yellow to Yellow |
| optical activity | [α]20/D 14.0±1.5°, c = 2% in acetone |
| InChI | 1S/C11H13FN4O5/c1-5(2)10(11(13)17)14-7-3-6(12)8(15(18)19)4-9(7)16(20)21/h3-5,10,14H,1-2H3,(H2,13,17)/t10-/m1/s1 |
| InChIKey | ZTFFRKNPAXXEBL-SNVBAGLBSA-N |
| SMILES | CC(C)[C@@H](Nc1cc(F)c(cc1[N+]([O-])=O)[N+]([O-])=O)C(N)=O |
Description and Uses
(R)-2-[(5-Fluoro-2,4-dinitrophenyl)amino]-3-methylbutanamide is a useful intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![2,4-Dinitrofluorobenzene [for HPLC Labeling]](https://img.chemicalbook.com/CAS/GIF/70-34-8.gif)