LN0556657
1-(5-fluoro-2-hydroxy-3-nitrophenyl)ethan-1-one , 97% , 70978-39-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB1306.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-90 °C (lit.) |
| Boiling point: | 240.9±35.0 °C(Predicted) |
| Density | 1.470±0.06 g/cm3(Predicted) |
| pka | 6.96±0.38(Predicted) |
| InChI | 1S/C8H6FNO4/c1-4(11)6-2-5(9)3-7(8(6)12)10(13)14/h2-3,12H,1H3 |
| InChIKey | YVTPUCHIOSGVSH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(F)cc(c1O)[N+]([O-])=O |
Description and Uses
5′-Fluoro-2′-hydroxy-3′-nitroacetophenone may be used to prepare 1-(3-amino-5-fluoro-2-hydroxyphenyl)ethanone via catalytic hydrogenation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




