LN0715358
Sophocarpine , 98% , 6483-15-4
| Pack Size | Price | Stock | Quantity |
| 1mL*10mM(inDMSO) | RMB413.60 | In Stock |
|
| 10mg | RMB549.60 | In Stock |
|
| 25mg | RMB981.60 | In Stock |
|
| 50mg | RMB1469.60 | In Stock |
|
| 100mg | RMB2205.60 | In Stock |
|
| 200mg | RMB3313.60 | In Stock |
|
| 500mg | RMB4969.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54~55℃ |
| Boiling point: | 170-210 °C(Press: 5 Torr) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| solubility | DMSO: 2 mg/ml; Ethanol: 1 mg/ml * |
| form | A crystalline solid |
| pka | 9.59±0.20(Predicted) |
| color | White to off-white |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,7,11-13,15H,2-6,8-10H2/t11-,12+,13+,15/m0/s1 |
| InChIKey | AAGFPTSOPGCENQ-IRYOAWFSSA-N |
| SMILES | N12CCC[C@]3([H])C1[C@@]([H])([C@@]1([H])CC=CC(=O)N1C3)CCC2 |
Description and Uses
Sophocarpine is an intermediate in the synthesis of (+)-Matrine-d3 (M197872). (+)-Matrine-d3, is a labeled analogue of (+)-Matrine, an alkaloid compound extracted from the roots of Sophora species which maintain anti-inflammatory, anti-cancer and a host of other positive pharmacological effects. Apoptotic agent.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H330 |
| Precautionary statements | P280-P310-P320-P405-P501 |






