LN0939557
98% , 1315478-13-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2604.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 385.0±44.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| pka | 9.49±0.50(Predicted) |
| InChI | InChI=1S/C13H21N3O2/c1-5-6-7-11-14-9(2)10(13(18)15-11)8-12(17)16(3)4/h5-8H2,1-4H3,(H,14,15,18) |
| InChIKey | OAMDXZTUOHORAO-UHFFFAOYSA-N |
| SMILES | C1(CCCC)NC(=O)C(CC(N(C)C)=O)=C(C)N=1 |
Description and Uses
As a complex organic compound, 2-(2-butyl-4-hydroxy-6-MethylpyriMidin-5-yl)-N,N-diMethylacetaMide may serve as an intermediate or a building block in the synthesis of other compounds. Its unique structure could be utilized in the development of novel chemical entities with potential applications in various fields.





![2-Butyl-1,6-dihydro-N,N,4-trimethyl-6-oxo-1-[[2'-[1-(triphenylmethyl)-1H-tetrazol-5-yl][1,1'-biphenyl]-4-yl]methyl]-5-pyrimidineacetamide](https://img.chemicalbook.com/CAS/20180906/GIF/503155-67-7.gif)
