LN1513645
Difenoxurone , Analysis standard reagent , 14214-32-5
CAS NO.：14214-32-5
Empirical Formula: C16H18N2O3
Molecular Weight: 286.33
MDL number: MFCD00055446
EINECS: 238-068-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB993.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138.5°C |
| Boiling point: | 428.69°C (rough estimate) |
| Density | 1.1190 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| storage temp. | 0-6°C |
| pka | 14.47±0.70(Predicted) |
| Water Solubility | 20mg/L(20 ºC) |
| BRN | 5574828 |
| Major Application | agriculture environmental |
| InChI | 1S/C16H18N2O3/c1-18(2)16(19)17-12-4-6-14(7-5-12)21-15-10-8-13(20-3)9-11-15/h4-11H,1-3H3,(H,17,19) |
| InChIKey | AMVYOVYGIJXTQB-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2ccc(NC(=O)N(C)C)cc2)cc1 |
| EPA Substance Registry System | Difenoxuron (14214-32-5) |
Description and Uses
Difenoxuron is a selective herbicide, mainly used to control allium weeds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | YT0180000 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
