LN1860539
98% , 106268-96-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB33.60 | In Stock |
|
| 250mg | RMB54.40 | In Stock |
|
| 1g | RMB153.60 | In Stock |
|
| 5g | RMB540.80 | In Stock |
|
| 25g | RMB1899.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-89 °C(lit.) |
| Boiling point: | 379.74°C (rough estimate) |
| Density | 1.3350 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, DCM |
| form | Solid |
| color | Light Yellow |
| optical activity | [α]19/D 5.9°, c = 2.4 in chloroform |
| InChI | InChI=1S/C11H12NO6/c1-11(5-13,6-18-11)9-4-7(12(16)17)2-3-8(9)10(14)15/h2-4,13H,5-6H2,1H3,(H,14,15) |
| InChIKey | KBYNTFSZTDWVEU-UHFFFAOYSA-N |
| SMILES | O1CC1(C)(C1=CC([N+]([O-])=O)=CC=C1C(O)=O)CO |
Description and Uses
(R)-(-)-2-Methylglycidyl 4-Nitrobenzoate is an intermediate in the synthesis of Delamanid (D230660), a novel anti-tuberculosis medication that inhibits mycolic acid synthesis and shows potent in-vitro and in-vivo activity against drug-resistant strains of Mycobacterium tuberculosis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | RR0510300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![[(Phenylmethoxy)methyl]oxirane (Benzyl Glycidyl Ether)](https://img.chemicalbook.com/CAS/GIF/2930-05-4.gif)
