PRODUCT Properties
| Melting point: | −126 °C(lit.) |
| Boiling point: | 0 °C |
| Density | 1.595±0.06 g/cm3(Predicted) |
| InChI | 1S/C4F8O/c5-2(6,4(10,11)12)1(13)3(7,8)9 |
| InChIKey | QJPLLYVRTUXAHZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=O)C(F)(F)C(F)(F)F |
Description and Uses
Reactant involved in synthesis of 2,3-bis(perfluoroalkyl)quinoxalines1
Safety
| Symbol(GHS) | ![]() ![]() GHS04,GHS06 |
| Signal word | Danger |
| Hazard statements | H280-H315-H319-H330-H335 |
| Precautionary statements | P260-P264-P302+P352-P304+P340+P310-P305+P351+P338-P410+P403 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1956 2.2 |
| WGK Germany | 3 |
| F | 4.5-21-31 |
| HazardClass | 2.3 |
| HS Code | 2914120000 |
| Storage Class | 2A - Gases |
| Hazard Classifications | Acute Tox. 2 Inhalation Eye Irrit. 2 Press. Gas Compr. Gas Skin Irrit. 2 STOT SE 3 |







