PRODUCT Properties
| Melting point: | 29-30 °C |
| Boiling point: | 320.68°C (rough estimate) |
| Density | 1.1579 (rough estimate) |
| refractive index | 1.5014 (estimate) |
| storage temp. | -20°C, Light sensitive |
| solubility | Chloroform, Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Red to Very Dark Purple |
| Stability: | Possibly shock sensitive |
| InChI | InChI=1S/C13H10N2/c1-3-7-11(8-4-1)13(14-15-13)12-9-5-2-6-10-12/h1-10H |
| InChIKey | YSIXZOWGRJZVLY-UHFFFAOYSA-N |
| SMILES | C1(N=N1)(C1C=CC=CC=1)C1=CC=CC=C1 |
Description and Uses
A alkylating agent for carboxylic acids; reagent for the synthesis of diphenylcyclopropanes from alkenes.
1,1-Diphenyldiazomethane is used to synthesize tartaric acid analogs of FR258900 as glycogen phosphorylase inhibitors.
