LN2110241
chlorideionophoreII , Selectophore,functiontested , 145889-57-2
Synonym(s):
4,5-Dimethyl-3,6-dioctyloxy-o-phenylene-bis(mercurytrifluoroacetate);ETH 9009
CAS NO.：145889-57-2
Empirical Formula: C28H40F6Hg2O6
Molecular Weight: 987.78
MDL number: MFCD00214158
| Pack Size | Price | Stock | Quantity |
| 0.025g | RMB1510.40 | In Stock |
|
| 0.1g | RMB4710.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-179 °C |
| form | powder |
| InChI | 1S/C24H40O2.2C2HF3O2.2Hg/c1-5-7-9-11-13-15-19-25-23-17-18-24(22(4)21(23)3)26-20-16-14-12-10-8-6-2;2*3-2(4,5)1(6)7;;/h5-16,19-20H2,1-4H3;2*(H,6,7);;/q;;;2*+1/p-2 |
| InChIKey | UMYVIFNPTFWRLT-UHFFFAOYSA-L |
| SMILES | CCCCCCCCOc1c(C)c(C)c(OCCCCCCCC)c([Hg]OC(=O)C(F)(F)F)c1[Hg]OC(=O)C(F)(F)F |
Description and Uses
Selected application examples
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H373-H410 |
| Precautionary statements | P262-P273-P280-P302+P352+P310-P304+P340+P310-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,N |
| Risk Statements | 26/27/28-33-50/53 |
| Safety Statements | 13-28-36-45-60-61 |
| RIDADR | UN 2025 6.1/PG 2 |
| WGK Germany | 3 |
| F | 9 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
