LN2257130
98% , 14167-20-5
Synonym(s):
[[α,α′-(Ethylenedinitrilo)di-o-cresolato](2-)]nickel;[[2,2′-[1,2-Ethanediylbis[(nitrilo-κN)methylidyne]]bis[phenolato-κO]](2-)]nickel;Nickel(II) salen
CAS NO.:14167-20-5
Empirical Formula: C16H14N2NiO2
Molecular Weight: 324.99
MDL number: MFCD00012041
| Pack Size | Price | Stock | Quantity |
| 5g | RMB880.00 | In Stock |
|
| 10g | RMB1591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >150 °C (decomp) |
| InChI | InChI=1S/C16H16N2O2.Ni/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;/h1-8,11-12,19-20H,9-10H2;/q;+2/p-2/b17-11+,18-12+; |
| InChIKey | DKBSGGSJQXGHBV-OYJDLGDISA-L |
| SMILES | C12C=CC=CC=1C=NCCN=CC1C=CC=CC=1O[Ni]O2 |t:7,11| |
Description and Uses
Catalyst for:
- Covalent functionalization of multiwall carbon nanotubes
- Reduction reactions
- Epoxidation reactions
- Reduction and intramolecular cyclization
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H317-H319-H334-H335-H350 |
| Precautionary statements | P201-P261-P280-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 45-20/21/22-36/37/38-42/43 |
| Safety Statements | 53-26-36/37/39-45 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |





