LN2260239
95% , 472-86-6
Synonym(s):
13-cis-Vitamin A aldehyde;Vitamin A aldehyde
CAS NO.:472-86-6
Empirical Formula: C20H28O
Molecular Weight: 284.44
MDL number: MFCD00074858
EINECS: 207-456-1
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB5740.80 | In Stock |
|
| 100mg | RMB9529.60 | In Stock |
|
| 250mg | RMB15882.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-69°C |
| Boiling point: | 366.92°C (rough estimate) |
| Density | 1.0083 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Yellow to Dark Yellow |
| biological source | synthetic (organic) |
| Stability: | Light Sensitive |
| InChI | 1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13- |
| InChIKey | NCYCYZXNIZJOKI-HWCYFHEPSA-N |
| SMILES | [H]C(=O)C(/[H])=C(C)\C=C\C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| EPA Substance Registry System | Retinal, 13-cis- (472-86-6) |
Description and Uses
An isomer of all-trans-Retinal (R240000).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H332 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-38 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Skin Irrit. 2 |




