PRODUCT Properties
| Melting point: | 234-238 °C(lit.) |
| Density | 1.3965 (estimate) |
| storage temp. | −20°C |
| solubility | H2O: 21 mg/mL |
| form | powder |
| color | white |
| Water Solubility | H2O: 21mg/mL |
| BRN | 3746109 |
| InChI | 1S/C12H19N2.HI/c1-14(2)10-8-13(9-11-14)12-6-4-3-5-7-12;/h3-7H,8-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XFZJGFIKQCCLGK-UHFFFAOYSA-M |
| SMILES | [I-].C[N+]1(C)CCN(CC1)c2ccccc2 |
| CAS DataBase Reference | 54-77-3(CAS DataBase Reference) |
Description and Uses
1,1-Dimethyl-4-phenylpiperazinium iodide is nicotinic acetylcholine receptor agonist. Nitrification inhibitor that can potentially increase fertilizer N use efficiency (NUE).
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H301+H311+H331-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P403+P233-P405-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | TM3385000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335995 |
| Storage Class | 11 - Combustible Solids |







