LN2393457
98% , 17289-54-2
CAS NO.：17289-54-2
Empirical Formula: C14H23ClN2O
Molecular Weight: 270.798
MDL number: MFCD01671541
| Pack Size | Price | Stock | Quantity |
| 1g | RMB4866.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-112 °C |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C14H22N2O.ClH/c1-5-16(6-2)10-14(17)15-13-8-7-11(3)9-12(13)4;/h7-9H,5-6,10H2,1-4H3,(H,15,17);1H |
| InChIKey | ZLAAATDLPBWPOO-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=C(C)C=C1C)(=O)CN(CC)CC.[H]Cl |
Description and Uses
2-(Diethylamino)-N-(2,4-dimethylphenyl)acetamide is an Lidocaine (L397800) derivative with reduced local anesthetic action.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
