LN2441339
98% , 73851-70-4
Synonym(s):
(N-[2-[[[5-[(DIMETHYLAMINO) METHYL]-2-FURANYL]METHYL] SULFINYL]ETHYL]-N-METHYL-2- NITRO-1,1-ETHENEDIAMINE;N-{2-{{{5-[(Dimethylamino)methyl]furan-2-yl}methyl}sulfinyl}ethyl}-N′-methyl-2-nitroethene-1,1-diamine;Ranitidine S-oxide
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB936.00 | In Stock |
|
| 10mg | RMB1563.20 | In Stock |
|
| 25mg | RMB3116.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-67°C |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Light Yellow to Dark Yellow |
| BRN | 8395257 |
| Stability: | Very Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H22N4O4S/c1-14-13(9-17(18)19)15-6-7-22(20)10-12-5-4-11(21-12)8-16(2)3/h4-5,9,14-15H,6-8,10H2,1-3H3 |
| InChIKey | SKHXRNHSZTXSLP-UHFFFAOYSA-N |
| SMILES | C(NCCS(CC1=CC=C(CN(C)C)O1)=O)(NC)=C[N+]([O-])=O |
Description and Uses
Ranitidine S-Oxide (Ranitidine EP Impurity C) is a metabolite of Ranitidine (R120000).
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334-H335 |
| Precautionary statements | P261-P280-P284-P304+P340+P312-P333+P313-P342+P311 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 37-42/43 |
| Safety Statements | 22-36/37 |
| WGK Germany | 3 |
| HS Code | 2932190002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 STOT SE 3 |




![2-[[[5-[(Dimethylamino)methyl]-2-furyl]methyl]thio]ethylamine](https://img.chemicalbook.com/CAS/GIF/66356-53-4.gif)

![N-[2-[5-(DIMETHYLAMINOMETHYL)-2-FURFURYLTHIO]ETHYL]-2-NITRO-ACETAMIDE SODIUM SALT](https://img.chemicalbook.com/CAS/GIF/112251-56-6.gif)
