LN2463245
β-Ionol , 90% , 22029-76-1
Synonym(s):
4-(2,6,6-Trimethyl-1-cyclohexenyl)-3-buten-2-ol;beta-Ionol
CAS NO.:22029-76-1
Empirical Formula: C13H22O
Molecular Weight: 194.31
MDL number: MFCD00036597
EINECS: 244-735-7
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB690.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 107 °C3 mm Hg(lit.) |
| Density | 0.928 g/mL at 20 °C(lit.) |
| refractive index | n |
| FEMA | 3625 | BETA-IONOL |
| Flash point: | 93.4 °C |
| pka | 14.68±0.20(Predicted) |
| form | liquid |
| Odor | at 100.00 %. sweet herbal floral violet tropical balsam woody |
| Odor Type | floral |
| JECFA Number | 392 |
| BRN | 1866761 |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C13H22O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8,11,14H,5-6,9H2,1-4H3/b8-7+ |
| InChIKey | CNOPDZWOYFOHGN-BQYQJAHWSA-N |
| SMILES | CC(O)\C=C\C1=C(C)CCCC1(C)C |
| LogP | 4.33 |
| EPA Substance Registry System | 3-Buten-2-ol, 4-(2,6,6-trimethyl-1-cyclohexen-1-yl)- (22029-76-1) |
Description and Uses
β-Ionol has a sweet, floral-balsamic warm odor.
β-Ionol can be used as food spice, suitable for the preparation of rose, lavender and other flavors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Safety Statements | 23-24/25 |
| WGK Germany | 2 |
| RTECS | EM9630000 |
| F | 10-23 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Toxicity | rabbit,LD50,skin,> 5gm/kg (5000mg/kg),Food and Chemical Toxicology. Vol. 26, Pg. 361, 1988. |





