LN2478457
95% , 39757-71-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB644.00 | In Stock |
|
| 1g | RMB1512.00 | In Stock |
|
| 5g | RMB4368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 326.6±42.0 °C(Predicted) |
| Density | 1.253±0.06 g/cm3(Predicted) |
| pka | 13.68±0.20(Predicted) |
| form | solid |
| InChI | 1S/C12H14F3NO/c13-12(14,15)10-3-1-9(2-4-10)11(17)5-7-16-8-6-11/h1-4,16-17H,5-8H2 |
| InChIKey | KZZLCYKEVNALMG-UHFFFAOYSA-N |
| SMILES | OC1(CCNCC1)c2ccc(cc2)C(F)(F)F |
Description and Uses
4-(4-Trifluoromethyl-phenyl)-piperidin-4-ol (cas# 39757-71-6) is an intermediate in the synthesis of trifluperidol (T793533).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
