LN2638341
N-(p-Sulfamoylphenethyl)acetamide , 98% , 41472-49-5
CAS NO.:41472-49-5
Empirical Formula: C10H14N2O3S
Molecular Weight: 242.29
MDL number: MFCD00193755
EINECS: 255-386-5
| Pack Size | Price | Stock | Quantity |
| 0.25g | RMB238.40 | In Stock |
|
| 1g | RMB798.40 | In Stock |
|
| 5g | RMB2958.40 | In Stock |
|
| 25g | RMB10399.20 | In Stock |
|
| 100g | RMB28000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-174°C |
| Density | 1.274±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 10.16±0.10(Predicted) |
| InChI | InChI=1S/C10H14N2O3S/c1-8(13)12-7-6-9-2-4-10(5-3-9)16(11,14)15/h2-5H,6-7H2,1H3,(H,12,13)(H2,11,14,15) |
| InChIKey | IIMGUEXQORZTID-UHFFFAOYSA-N |
| SMILES | C(NCCC1=CC=C(S(N)(=O)=O)C=C1)(=O)C |
| CAS DataBase Reference | 41472-49-5(CAS DataBase Reference) |
Description and Uses
N-[2-[4-(Aminosulfonyl)phenyl]ethyl]-acetamide is used in the synthesis of sulfonylurea and thiourea derivatives substituted with benzenesulfonamide groups that can be used as potential hypoglycemic agents.
Safety
| HS Code | 2935909099 |
| REACH Registrations | Active |





![5-Chloro-2-methoxy-N-[2-(4-sulfamoylphenyl)ethyl]benzamide](https://img.chemicalbook.com/CAS/GIF/16673-34-0.gif)