LN2679757
97% , 45234-02-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1568.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-197 °C |
| Boiling point: | 596.4±50.0 °C(Predicted) |
| Density | 1.290±0.06 g/cm3(Predicted) |
| storage temp. | -15°C |
| pka | 3.00±0.10(Predicted) |
| form | solid |
| InChI | InChI=1S/C11H21N3O5/c12-6-2-1-3-7(13)10(17)14-8(11(18)19)4-5-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1 |
| InChIKey | UGTZHPSKYRIGRJ-YUMQZZPRSA-N |
| SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)N |
Description and Uses
Lysylglutamic acid is a dipeptide formed by combining two amino acids, Lysine (Lys) and Glutamic acid (Glu). The Ki value of the membrane transporter PEPT1 was 1.3 mM[1].



