LN2834154
95% , 19715-80-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB572.00 | In Stock |
|
| 1g | RMB1393.60 | In Stock |
|
| 5g | RMB4207.20 | In Stock |
|
| 10g | RMB6911.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66 °C |
| Boiling point: | 335.9±25.0 °C(Predicted) |
| Density | 1.377±0.06 g/cm3(Predicted) |
| storage temp. | Store at Room Tem. |
| pka | -0.61±0.70(Predicted) |
| form | solid |
| InChI | 1S/C10H12BrNO/c1-12(2)10(13)7-8-3-5-9(11)6-4-8/h3-6H,7H2,1-2H3 |
| InChIKey | CNGVHZAORFMGBW-UHFFFAOYSA-N |
| SMILES | O=C(CC1=CC=C(Br)C=C1)N(C)C |
Description and Uses
2-(4-Bromophenyl)-N,N-dimethylacetamide (cas# 19715-80-1) can be used in the preparation of bicyclic pyridine compositions, which may be used in cancer therapy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 13 - Non Combustible Solids |


