LN2910221
95%, 70%methanol solution , 3155-48-4
Synonym(s):
trans-5,6-Dihydro-4-methoxy-6-(2-phenylethenyl)-2H-pyran-2-one;DL -Kawain
| Pack Size | Price | Stock | Quantity |
| 1ug | RMB3405.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-148 °C |
| Boiling point: | 432.6±45.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | Off-White to Pale Yellow |
| BRN | 177877 |
| Stability: | Light and Moisture Sensitive |
| Major Application | food and beverages |
| InChI | InChI=1S/C14H14O3/c1-16-13-9-12(17-14(15)10-13)8-7-11-5-3-2-4-6-11/h2-8,10,12H,9H2,1H3/b8-7+ |
| InChIKey | XEAQIWGXBXCYFX-BQYQJAHWSA-N |
| SMILES | C1(=O)OC(/C=C/C2=CC=CC=C2)CC(OC)=C1 |
| LogP | 1.690 (est) |
| CAS DataBase Reference | 3155-48-4(CAS DataBase Reference) |
Description and Uses
anticonvulsant, analgesic, anxiolytic, suppreses excitatory postsynaptic potential
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




