PRODUCT Properties
| Density | 1.617[at 20℃] |
| Water Solubility | 17.27g/L at 20℃ |
| InChIKey | XYNGYONLRYFQNO-UUIOKUIJSA-N |
| SMILES | S(C1C=C(/N=N/C2C(=NN(C3C=CC=CC=3)C2=O)C)C=CC=1C1C=CC(/N=N/C2C(=NN(C3C=CC=CC=3)C2=O)C)=CC=1S(O)(=O)=O)(O)(=O)=O.[NaH] |
| LogP | -1.122 at 20℃ |
| EPA Substance Registry System | C.I. Acid Yellow 42, disodium salt (6375-55-9) |
Description and Uses
C.I. Acid yellow 42 is an acidic yellow dye that can be adsorbed and removed by bentone.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H317 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
