LN3322849
Trimipramine-d3(maleate) , ≥98% , 1185245-93-5
CAS NO.：1185245-93-5
Empirical Formula: C24H27D3N2O4
Molecular Weight: 413.524
MDL number: MFCD09952294
EINECS: 200-659-6
| Pack Size | Price | Stock | Quantity |
| 500ug | RMB904.00 | In Stock |
|
| 1mg | RMB1624.00 | In Stock |
|
| 5mg | RMB6492.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Pale Grey |
| Major Application | clinical testing |
| InChI | 1S/C20H26N2.C4H4O4/c1-16(14-21(2)3)15-22-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)22;5-3(6)1-2-4(7)8/h4-11,16H,12-15H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/i2D3; |
| InChIKey | YDGHCKHAXOUQOS-QWPULOJDSA-N |
| SMILES | O=C(O)/C=C\C(O)=O.CC(CN(C)C([2H])([2H])[2H])CN1C2=CC=CC=C2CCC3=C1C=CC=C3 |
Description and Uses
Antidepressant; serotonin transport blocker that also blocks norepinephrine uptake.
Safety
| Symbol(GHS) |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
