BD2961545
TrimipramineMaleate , 99+% , 521-78-8
Synonym(s):
Trimipramine maleate salt
CAS NO.:521-78-8
Empirical Formula: C24H30N2O4
Molecular Weight: 410.51
MDL number: MFCD00082376
EINECS: 208-318-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB186.40 | In Stock |
|
| 250mg | RMB261.60 | In Stock |
|
| 1g | RMB628.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-143°C |
| Flash point: | 11 °C |
| storage temp. | 2-8°C |
| solubility | chloroform: soluble50 mg/ml, clear, colorless to faintly yellow |
| form | powder |
| color | white |
| InChI | InChI=1S/C20H26N2.C4H4O4/c1-16(14-21(2)3)15-22-19-10-6-4-8-17(19)12-13-18-9-5-7-11-20(18)22;5-3(6)1-2-4(7)8/h4-11,16H,12-15H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | YDGHCKHAXOUQOS-BTJKTKAUSA-N |
| SMILES | N1(CC(C)CN(C)C)C2C(=CC=CC=2)CCC2C=CC=CC1=2.C(/C(=O)O)=C/C(=O)O |
| EPA Substance Registry System | Trimipramine maleate (521-78-8) |
Description and Uses
Antidepressant; serotonin transport blocker that also blocks norepinephrine uptake.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H361 |
| Precautionary statements | P202-P261-P301+P312-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,T,F |
| Risk Statements | 22-36/37/38-63-36/38-23/25-39/23/24/25-23/24/25-11 |
| Safety Statements | 26-36-45-33-24-16-7-36/37 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | HN9260000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933996100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT SE 3 |








