LN3420739
95% , 33124-04-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB792.00 | In Stock |
|
| 250mg | RMB1440.00 | In Stock |
|
| 1g | RMB2880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 203.2±33.0 °C(Predicted) |
| Density | 1.167±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| pka | 6.17±0.10(Predicted) |
| Appearance | Light brown to brown Solid |
| InChI | InChI=1S/C4H6N2O/c1-3-2-6-4(5)7-3/h2H,1H3,(H2,5,6) |
| InChIKey | DYYFCNDEROYKKJ-UHFFFAOYSA-N |
| SMILES | O1C(C)=CN=C1N |
Description and Uses
5-Methyl-oxazol-2-ylamine is a synthetic building block that can be used to prepare anti-cancer and anti-inflammatory drugs, luminescent metal complexes, or chemical reagents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |







